About 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide (PubChem CID 114266293) has the molecular formula C9H19N3O4S
and a molecular weight of 265.33 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide |
| PubChem CID | 114266293 |
| Molecular Formula | C9H19N3O4S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide |
| SMILES | CC(OCCN1CCS(=O)(=O)CC1)C(N)=NO |
| InChI | InChI=1S/C9H19N3O4S/c1-8(9(10)11-13)16-5-2-12-3-6-17(14,15)7-4-12/h8,13H,2-7H2,1H3,(H2,10,11) |
| InChIKey | VMUVDQOYIHFPFL-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide?
The IUPAC name of 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide (CID 114266293) is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide.
What is the SMILES notation for 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide?
The canonical SMILES for 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide is CC(OCCN1CCS(=O)(=O)CC1)C(N)=NO.
What is the InChIKey of 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide?
The InChIKey is VMUVDQOYIHFPFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O4S/c1-8(9(10)11-13)16-5-2-12-3-6-17(14,15)7-4-12/h8,13H,2-7H2,1H3,(H2,10,11).
What are the key properties of 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide?
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide has a molecular weight of 265.33 g/mol, XLogP of -1.13, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]-N'-hydroxypropanimidamide is sourced from PubChem (CID 114266293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).