C20H30O2 — CID 11426630
(4S,5R)-5-[[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-4-hydroxycyclopent-2-en-1-one (PubChem CID 11426630) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (4S,5R)-5-[[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-4-hydroxycyclopent-2-en-1-one.
| Compound Name | (4S,5R)-5-[[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-4-hydroxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11426630 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (4S,5R)-5-[[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-4-hydroxycyclopent-2-en-1-one |
| SMILES | CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@H]1C(=O)C=C[C@@H]1O |
| InChI | InChI=1S/C20H30O2/c1-13-6-9-18-19(2,3)10-5-11-20(18,4)15(13)12-14-16(21)7-8-17(14)22/h6-8,14-16,18,21H,5,9-12H2,1-4H3/t14-,15+,16+,18+,20-/m1/s1 |
| InChIKey | LQTADMSVJQUTPA-POSZSDEYSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|