C19H30N2O3 — CID 114266808
tert-butyl N-[[2-[1-(oxolan-3-yl)propylamino]phenyl]methyl]carbamate (PubChem CID 114266808) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl N-[[2-[1-(oxolan-3-yl)propylamino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[1-(oxolan-3-yl)propylamino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 114266808 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | tert-butyl N-[[2-[1-(oxolan-3-yl)propylamino]phenyl]methyl]carbamate |
| SMILES | CCC(Nc1ccccc1CNC(=O)OC(C)(C)C)C1CCOC1 |
| InChI | InChI=1S/C19H30N2O3/c1-5-16(15-10-11-23-13-15)21-17-9-7-6-8-14(17)12-20-18(22)24-19(2,3)4/h6-9,15-16,21H,5,10-13H2,1-4H3,(H,20,22) |
| InChIKey | XJPDOSNLTAHXAD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |