C12H16FN3S — CID 114267002
2-(2-fluoroethylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide (PubChem CID 114267002) has the molecular formula C12H16FN3S and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(2-fluoroethylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide.
| Compound Name | 2-(2-fluoroethylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
|---|---|
| PubChem CID | 114267002 |
| Molecular Formula | C12H16FN3S |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-(2-fluoroethylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
| SMILES | NC(=S)c1cc2c(nc1NCCF)CCCC2 |
| InChI | InChI=1S/C12H16FN3S/c13-5-6-15-12-9(11(14)17)7-8-3-1-2-4-10(8)16-12/h7H,1-6H2,(H2,14,17)(H,15,16) |
| InChIKey | MGJSRZBISASDRL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|