C9H15FN4O2S — CID 114267276
4-amino-N-(2-fluoroethyl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide (PubChem CID 114267276) has the molecular formula C9H15FN4O2S and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-amino-N-(2-fluoroethyl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(2-fluoroethyl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 114267276 |
| Molecular Formula | C9H15FN4O2S |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-amino-N-(2-fluoroethyl)-2-(2-methoxyethylamino)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNc1nc(N)c(C(=O)NCCF)s1 |
| InChI | InChI=1S/C9H15FN4O2S/c1-16-5-4-13-9-14-7(11)6(17-9)8(15)12-3-2-10/h2-5,11H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | KVYYQKVAUSJYDG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|