C17H22O3S — CID 11426749
methyl (2Z,6E)-5,5-dimethyl-7-[(R)-(4-methylphenyl)sulfinyl]hepta-2,6-dienoate (PubChem CID 11426749) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is methyl (2Z,6E)-5,5-dimethyl-7-[(R)-(4-methylphenyl)sulfinyl]hepta-2,6-dienoate.
| Compound Name | methyl (2Z,6E)-5,5-dimethyl-7-[(R)-(4-methylphenyl)sulfinyl]hepta-2,6-dienoate |
|---|---|
| PubChem CID | 11426749 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | methyl (2Z,6E)-5,5-dimethyl-7-[(R)-(4-methylphenyl)sulfinyl]hepta-2,6-dienoate |
| SMILES | COC(=O)/C=C\CC(C)(C)/C=C/[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H22O3S/c1-14-7-9-15(10-8-14)21(19)13-12-17(2,3)11-5-6-16(18)20-4/h5-10,12-13H,11H2,1-4H3/b6-5-,13-12+/t21-/m1/s1 |
| InChIKey | IUGGUTSHACVGIR-CMMJYFHCSA-N |
| XLogP | 3.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|