C11H9Cl2IN4O — CID 114267809
3-[2-(2,4-dichloro-6-methylpyrimidin-5-yl)ethyl]-5-iodopyrimidin-4-one (PubChem CID 114267809) has the molecular formula C11H9Cl2IN4O and a molecular weight of 411.03 g/mol. Its IUPAC name is 3-[2-(2,4-dichloro-6-methylpyrimidin-5-yl)ethyl]-5-iodopyrimidin-4-one.
| Compound Name | 3-[2-(2,4-dichloro-6-methylpyrimidin-5-yl)ethyl]-5-iodopyrimidin-4-one |
|---|---|
| PubChem CID | 114267809 |
| Molecular Formula | C11H9Cl2IN4O |
| Molecular Weight | 411.03 g/mol |
| Exact Mass | 409.92 |
| IUPAC Name | 3-[2-(2,4-dichloro-6-methylpyrimidin-5-yl)ethyl]-5-iodopyrimidin-4-one |
| SMILES | Cc1nc(Cl)nc(Cl)c1CCn1cncc(I)c1=O |
| InChI | InChI=1S/C11H9Cl2IN4O/c1-6-7(9(12)17-11(13)16-6)2-3-18-5-15-4-8(14)10(18)19/h4-5H,2-3H2,1H3 |
| InChIKey | BFPRVGFQZNABKS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.03 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|