C19H20N2O2 — CID 11426817
(2R,6R)-2-isocyanato-7,7,10-trimethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),8,11,13-tetraen-16-one (PubChem CID 11426817) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2R,6R)-2-isocyanato-7,7,10-trimethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),8,11,13-tetraen-16-one.
| Compound Name | (2R,6R)-2-isocyanato-7,7,10-trimethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),8,11,13-tetraen-16-one |
|---|---|
| PubChem CID | 11426817 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2R,6R)-2-isocyanato-7,7,10-trimethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),8,11,13-tetraen-16-one |
| SMILES | Cn1cc2c3c(cccc31)[C@]1(N=C=O)CCC[C@@H](C1=O)C2(C)C |
| InChI | InChI=1S/C19H20N2O2/c1-18(2)13-7-5-9-19(17(13)23,20-11-22)12-6-4-8-15-16(12)14(18)10-21(15)3/h4,6,8,10,13H,5,7,9H2,1-3H3/t13-,19+/m0/s1 |
| InChIKey | MIQQFFHCPYGSSR-ORAYPTAESA-N |
| XLogP | 3.37 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|