About 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile
3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile (PubChem CID 114268224) has the molecular formula C11H18N4OS
and a molecular weight of 254.36 g/mol. Its IUPAC name is 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile.
Molecular Properties
| Compound Name | 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile |
| PubChem CID | 114268224 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile |
| SMILES | COC(C)c1nsc(N(CCC#N)C(C)C)n1 |
| InChI | InChI=1S/C11H18N4OS/c1-8(2)15(7-5-6-12)11-13-10(14-17-11)9(3)16-4/h8-9H,5,7H2,1-4H3 |
| InChIKey | WUXJDEUHLNAPJD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile?
The IUPAC name of 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile (CID 114268224) is 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile.
What is the SMILES notation for 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile?
The canonical SMILES for 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile is COC(C)c1nsc(N(CCC#N)C(C)C)n1.
What is the InChIKey of 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile?
The InChIKey is WUXJDEUHLNAPJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4OS/c1-8(2)15(7-5-6-12)11-13-10(14-17-11)9(3)16-4/h8-9H,5,7H2,1-4H3.
What are the key properties of 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile?
3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile has a molecular weight of 254.36 g/mol, XLogP of 2.37, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(1-methoxyethyl)-1,2,4-thiadiazol-5-yl]-propan-2-ylamino]propanenitrile is sourced from PubChem (CID 114268224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).