C17H24O3S — CID 11426828
3-(3,3-dimethoxy-1-phenylsulfanylpropyl)cyclohexan-1-one (PubChem CID 11426828) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is 3-(3,3-dimethoxy-1-phenylsulfanylpropyl)cyclohexan-1-one.
| Compound Name | 3-(3,3-dimethoxy-1-phenylsulfanylpropyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11426828 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-(3,3-dimethoxy-1-phenylsulfanylpropyl)cyclohexan-1-one |
| SMILES | COC(CC(Sc1ccccc1)C1CCCC(=O)C1)OC |
| InChI | InChI=1S/C17H24O3S/c1-19-17(20-2)12-16(13-7-6-8-14(18)11-13)21-15-9-4-3-5-10-15/h3-5,9-10,13,16-17H,6-8,11-12H2,1-2H3 |
| InChIKey | AGGBLXLHFMPKKB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|