C13H18Cl2O4 — CID 11426838
[(2S)-6,7-dichloro-1-methyl-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11426838) has the molecular formula C13H18Cl2O4 and a molecular weight of 309.19 g/mol. Its IUPAC name is [(2S)-6,7-dichloro-1-methyl-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2S)-6,7-dichloro-1-methyl-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11426838 |
| Molecular Formula | C13H18Cl2O4 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | [(2S)-6,7-dichloro-1-methyl-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC(=O)C2C(Cl)C(Cl)C21C |
| InChI | InChI=1S/C13H18Cl2O4/c1-12(2,3)11(17)18-5-6-13(4)7(10(16)19-6)8(14)9(13)15/h6-9H,5H2,1-4H3/t6-,7?,8?,9?,13?/m1/s1 |
| InChIKey | XDHOHXMJUGQHQG-RMORJWIASA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|