C13H25N3OS — CID 114268880
2-methoxy-N-[[3-methyl-1-(2-propan-2-ylsulfanylethyl)pyrazol-4-yl]methyl]ethanamine (PubChem CID 114268880) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is 2-methoxy-N-[[3-methyl-1-(2-propan-2-ylsulfanylethyl)pyrazol-4-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[3-methyl-1-(2-propan-2-ylsulfanylethyl)pyrazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 114268880 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-methoxy-N-[[3-methyl-1-(2-propan-2-ylsulfanylethyl)pyrazol-4-yl]methyl]ethanamine |
| SMILES | COCCNCc1cn(CCSC(C)C)nc1C |
| InChI | InChI=1S/C13H25N3OS/c1-11(2)18-8-6-16-10-13(12(3)15-16)9-14-5-7-17-4/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | IWSYSBISLMEOMH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|