About 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane
1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane (PubChem CID 114268902) has the molecular formula C13H22N4O
and a molecular weight of 250.35 g/mol. Its IUPAC name is 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane |
| PubChem CID | 114268902 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane |
| SMILES | COc1ccc(CN2CCCNC(C)(C)C2)nn1 |
| InChI | InChI=1S/C13H22N4O/c1-13(2)10-17(8-4-7-14-13)9-11-5-6-12(18-3)16-15-11/h5-6,14H,4,7-10H2,1-3H3 |
| InChIKey | OMQOGKYKCQMUJU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane?
The IUPAC name of 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane (CID 114268902) is 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane.
What is the SMILES notation for 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane?
The canonical SMILES for 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane is COc1ccc(CN2CCCNC(C)(C)C2)nn1.
What is the InChIKey of 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane?
The InChIKey is OMQOGKYKCQMUJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O/c1-13(2)10-17(8-4-7-14-13)9-11-5-6-12(18-3)16-15-11/h5-6,14H,4,7-10H2,1-3H3.
What are the key properties of 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane?
1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane has a molecular weight of 250.35 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-methoxypyridazin-3-yl)methyl]-3,3-dimethyl-1,4-diazepane is sourced from PubChem (CID 114268902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).