C13H17BrClNO2S — CID 114269439
1-(2-bromo-6-chlorophenyl)sulfonyl-2,4-dimethylpiperidine (PubChem CID 114269439) has the molecular formula C13H17BrClNO2S and a molecular weight of 366.71 g/mol. Its IUPAC name is 1-(2-bromo-6-chlorophenyl)sulfonyl-2,4-dimethylpiperidine.
| Compound Name | 1-(2-bromo-6-chlorophenyl)sulfonyl-2,4-dimethylpiperidine |
|---|---|
| PubChem CID | 114269439 |
| Molecular Formula | C13H17BrClNO2S |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 1-(2-bromo-6-chlorophenyl)sulfonyl-2,4-dimethylpiperidine |
| SMILES | CC1CCN(S(=O)(=O)c2c(Cl)cccc2Br)C(C)C1 |
| InChI | InChI=1S/C13H17BrClNO2S/c1-9-6-7-16(10(2)8-9)19(17,18)13-11(14)4-3-5-12(13)15/h3-5,9-10H,6-8H2,1-2H3 |
| InChIKey | WZPCEUQWURWLDC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |