C14H21FN2O — CID 114270471
2-fluoro-5-(2,3,3-trimethylbutylamino)benzamide (PubChem CID 114270471) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-fluoro-5-(2,3,3-trimethylbutylamino)benzamide.
| Compound Name | 2-fluoro-5-(2,3,3-trimethylbutylamino)benzamide |
|---|---|
| PubChem CID | 114270471 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-fluoro-5-(2,3,3-trimethylbutylamino)benzamide |
| SMILES | CC(CNc1ccc(F)c(C(N)=O)c1)C(C)(C)C |
| InChI | InChI=1S/C14H21FN2O/c1-9(14(2,3)4)8-17-10-5-6-12(15)11(7-10)13(16)18/h5-7,9,17H,8H2,1-4H3,(H2,16,18) |
| InChIKey | OEQHZVXEAFDPAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |