About 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide
4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide (PubChem CID 114270919) has the molecular formula C12H15BrClFN2O
and a molecular weight of 337.62 g/mol. Its IUPAC name is 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide |
| PubChem CID | 114270919 |
| Molecular Formula | C12H15BrClFN2O |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCOc1cc(F)c(Br)cc1Cl |
| InChI | InChI=1S/C12H15BrClFN2O/c1-12(2,11(16)17)3-4-18-10-6-9(15)7(13)5-8(10)14/h5-6H,3-4H2,1-2H3,(H3,16,17) |
| InChIKey | NKNDTFBXFXIBFF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide?
The IUPAC name of 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide (CID 114270919) is 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide.
What is the SMILES notation for 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide?
The canonical SMILES for 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide is [H]/N=C(\N)C(C)(C)CCOc1cc(F)c(Br)cc1Cl.
What is the InChIKey of 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide?
The InChIKey is NKNDTFBXFXIBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrClFN2O/c1-12(2,11(16)17)3-4-18-10-6-9(15)7(13)5-8(10)14/h5-6H,3-4H2,1-2H3,(H3,16,17).
What are the key properties of 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide?
4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide has a molecular weight of 337.62 g/mol, XLogP of 3.97, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-2-chloro-5-fluorophenoxy)-2,2-dimethylbutanimidamide is sourced from PubChem (CID 114270919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).