C11H12N6O3 — CID 114271700
4-hydrazinyl-N-(1H-imidazol-2-yl)-2-methyl-5-nitrobenzamide (PubChem CID 114271700) has the molecular formula C11H12N6O3 and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-hydrazinyl-N-(1H-imidazol-2-yl)-2-methyl-5-nitrobenzamide.
| Compound Name | 4-hydrazinyl-N-(1H-imidazol-2-yl)-2-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 114271700 |
| Molecular Formula | C11H12N6O3 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-hydrazinyl-N-(1H-imidazol-2-yl)-2-methyl-5-nitrobenzamide |
| SMILES | Cc1cc(NN)c([N+](=O)[O-])cc1C(=O)Nc1ncc[nH]1 |
| InChI | InChI=1S/C11H12N6O3/c1-6-4-8(16-12)9(17(19)20)5-7(6)10(18)15-11-13-2-3-14-11/h2-5,16H,12H2,1H3,(H2,13,14,15,18) |
| InChIKey | KXRGCRDOIWWSOP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 138.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|