About N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide
N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide (PubChem CID 11427204) has the molecular formula C16H20N2OS2
and a molecular weight of 320.48 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide.
Molecular Properties
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide |
| PubChem CID | 11427204 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide |
| SMILES | O=C(CCCCCCS)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H20N2OS2/c19-15(10-6-1-2-7-11-20)18-16-17-14(12-21-16)13-8-4-3-5-9-13/h3-5,8-9,12,20H,1-2,6-7,10-11H2,(H,17,18,19) |
| InChIKey | LUXAHBUKMVESIS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide?
The IUPAC name of N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide (CID 11427204) is N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide.
What is the SMILES notation for N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide?
The canonical SMILES for N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide is O=C(CCCCCCS)Nc1nc(-c2ccccc2)cs1.
What is the InChIKey of N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide?
The InChIKey is LUXAHBUKMVESIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2OS2/c19-15(10-6-1-2-7-11-20)18-16-17-14(12-21-16)13-8-4-3-5-9-13/h3-5,8-9,12,20H,1-2,6-7,10-11H2,(H,17,18,19).
What are the key properties of N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide?
N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide has a molecular weight of 320.48 g/mol, XLogP of 4.63, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-phenyl-1,3-thiazol-2-yl)-7-sulfanylheptanamide is sourced from PubChem (CID 11427204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).