About 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid
5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid (PubChem CID 11427207) has the molecular formula C15H13ClN2O4
and a molecular weight of 320.73 g/mol. Its IUPAC name is 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid.
Molecular Properties
| Compound Name | 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid |
| PubChem CID | 11427207 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid |
| SMILES | Clc1ccc2c(c1)CC/C2=C/c1cnc[nH]1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H11ClN2.C2H2O4/c14-11-3-4-13-9(5-11)1-2-10(13)6-12-7-15-8-16-12;3-1(4)2(5)6/h3-8H,1-2H2,(H,15,16);(H,3,4)(H,5,6)/b10-6-; |
| InChIKey | XTARLSOKHDWZBZ-OTUCAILMSA-N |
| XLogP | 2.71 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid?
The IUPAC name of 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid (CID 11427207) is 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid.
What is the SMILES notation for 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid?
The canonical SMILES for 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid is Clc1ccc2c(c1)CC/C2=C/c1cnc[nH]1.O=C(O)C(=O)O.
What is the InChIKey of 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid?
The InChIKey is XTARLSOKHDWZBZ-OTUCAILMSA-N. The full InChI is InChI=1S/C13H11ClN2.C2H2O4/c14-11-3-4-13-9(5-11)1-2-10(13)6-12-7-15-8-16-12;3-1(4)2(5)6/h3-8H,1-2H2,(H,15,16);(H,3,4)(H,5,6)/b10-6-;.
What are the key properties of 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid?
5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid has a molecular weight of 320.73 g/mol, XLogP of 2.71, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-(5-chloro-2,3-dihydroinden-1-ylidene)methyl]-1H-imidazole;oxalic acid is sourced from PubChem (CID 11427207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).