C14H24N2O — CID 114272189
N-(3-butoxypropyl)-2,6-dimethylpyridin-4-amine (PubChem CID 114272189) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2,6-dimethylpyridin-4-amine.
| Compound Name | N-(3-butoxypropyl)-2,6-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 114272189 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-(3-butoxypropyl)-2,6-dimethylpyridin-4-amine |
| SMILES | CCCCOCCCNc1cc(C)nc(C)c1 |
| InChI | InChI=1S/C14H24N2O/c1-4-5-8-17-9-6-7-15-14-10-12(2)16-13(3)11-14/h10-11H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | ONYUVCAYQCTCCF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|