About 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine
4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine (PubChem CID 114272272) has the molecular formula C17H25N
and a molecular weight of 243.39 g/mol. Its IUPAC name is 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine |
| PubChem CID | 114272272 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine |
| SMILES | CC1CC(c2ccc(C3CCC3)cc2)CC(C)N1 |
| InChI | InChI=1S/C17H25N/c1-12-10-17(11-13(2)18-12)16-8-6-15(7-9-16)14-4-3-5-14/h6-9,12-14,17-18H,3-5,10-11H2,1-2H3 |
| InChIKey | KMNUUHGEGQPTPH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine?
The IUPAC name of 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine (CID 114272272) is 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine.
What is the SMILES notation for 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine?
The canonical SMILES for 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine is CC1CC(c2ccc(C3CCC3)cc2)CC(C)N1.
What is the InChIKey of 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine?
The InChIKey is KMNUUHGEGQPTPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N/c1-12-10-17(11-13(2)18-12)16-8-6-15(7-9-16)14-4-3-5-14/h6-9,12-14,17-18H,3-5,10-11H2,1-2H3.
What are the key properties of 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine?
4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine has a molecular weight of 243.39 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyclobutylphenyl)-2,6-dimethylpiperidine is sourced from PubChem (CID 114272272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).