C16H23NS — CID 114272345
2-prop-2-enylsulfanyl-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 114272345) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is 2-prop-2-enylsulfanyl-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 2-prop-2-enylsulfanyl-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 114272345 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-prop-2-enylsulfanyl-N-propyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | C=CCSC1CCc2ccccc2C1NCCC |
| InChI | InChI=1S/C16H23NS/c1-3-11-17-16-14-8-6-5-7-13(14)9-10-15(16)18-12-4-2/h4-8,15-17H,2-3,9-12H2,1H3 |
| InChIKey | JAAWGMUQPFFUEY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|