C19H30O4 — CID 11427260
tert-butyl 8-[(3aS,4S,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-4-yl]octanoate (PubChem CID 11427260) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is tert-butyl 8-[(3aS,4S,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-4-yl]octanoate.
| Compound Name | tert-butyl 8-[(3aS,4S,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-4-yl]octanoate |
|---|---|
| PubChem CID | 11427260 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl 8-[(3aS,4S,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-4-yl]octanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCC[C@H]1C=C[C@H]2OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C19H30O4/c1-19(2,3)23-17(20)10-8-6-4-5-7-9-14-11-12-16-15(14)13-18(21)22-16/h11-12,14-16H,4-10,13H2,1-3H3/t14-,15-,16+/m0/s1 |
| InChIKey | HGDMMCNPNIKDLC-HRCADAONSA-N |
| XLogP | 4.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|