C15H20N4O — CID 114273282
5-[hydrazinyl-(2-methoxyphenyl)methyl]-N,N-dimethylpyridin-2-amine (PubChem CID 114273282) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-[hydrazinyl-(2-methoxyphenyl)methyl]-N,N-dimethylpyridin-2-amine.
| Compound Name | 5-[hydrazinyl-(2-methoxyphenyl)methyl]-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 114273282 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 5-[hydrazinyl-(2-methoxyphenyl)methyl]-N,N-dimethylpyridin-2-amine |
| SMILES | COc1ccccc1C(NN)c1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C15H20N4O/c1-19(2)14-9-8-11(10-17-14)15(18-16)12-6-4-5-7-13(12)20-3/h4-10,15,18H,16H2,1-3H3 |
| InChIKey | QLWJBBBSIUNFCA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|