C17H23N — CID 114273370
1-[(4-tert-butylphenyl)methyl]-3,4-dimethylpyrrole (PubChem CID 114273370) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3,4-dimethylpyrrole.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3,4-dimethylpyrrole |
|---|---|
| PubChem CID | 114273370 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3,4-dimethylpyrrole |
| SMILES | Cc1cn(Cc2ccc(C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C17H23N/c1-13-10-18(11-14(13)2)12-15-6-8-16(9-7-15)17(3,4)5/h6-11H,12H2,1-5H3 |
| InChIKey | LQKLRDLTISTJNU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |