C12H22N4O2 — CID 114274001
5-(4-ethoxypyrazol-1-yl)-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 114274001) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 5-(4-ethoxypyrazol-1-yl)-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-(4-ethoxypyrazol-1-yl)-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 114274001 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 5-(4-ethoxypyrazol-1-yl)-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | CCOc1cnn(CCCC(C)(C)C(N)=NO)c1 |
| InChI | InChI=1S/C12H22N4O2/c1-4-18-10-8-14-16(9-10)7-5-6-12(2,3)11(13)15-17/h8-9,17H,4-7H2,1-3H3,(H2,13,15) |
| InChIKey | RUKDRCOZPGLRAQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|