C12H19N3O3 — CID 114274338
methyl 1-amino-3-(4-ethoxypyrazol-1-yl)cyclopentane-1-carboxylate (PubChem CID 114274338) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 1-amino-3-(4-ethoxypyrazol-1-yl)cyclopentane-1-carboxylate.
| Compound Name | methyl 1-amino-3-(4-ethoxypyrazol-1-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 114274338 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | methyl 1-amino-3-(4-ethoxypyrazol-1-yl)cyclopentane-1-carboxylate |
| SMILES | CCOc1cnn(C2CCC(N)(C(=O)OC)C2)c1 |
| InChI | InChI=1S/C12H19N3O3/c1-3-18-10-7-14-15(8-10)9-4-5-12(13,6-9)11(16)17-2/h7-9H,3-6,13H2,1-2H3 |
| InChIKey | MDPVFWXWTGLVRJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |