C19H33NO2Si — CID 11427647
(4R,10aR)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,4,7,9,10-hexahydro-1H-cyclopenta[i]indolizin-6-one (PubChem CID 11427647) has the molecular formula C19H33NO2Si and a molecular weight of 335.56 g/mol. Its IUPAC name is (4R,10aR)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,4,7,9,10-hexahydro-1H-cyclopenta[i]indolizin-6-one.
| Compound Name | (4R,10aR)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,4,7,9,10-hexahydro-1H-cyclopenta[i]indolizin-6-one |
|---|---|
| PubChem CID | 11427647 |
| Molecular Formula | C19H33NO2Si |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (4R,10aR)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,3,4,7,9,10-hexahydro-1H-cyclopenta[i]indolizin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H]1CCC[C@@]23CCC=C2CC(=O)N13 |
| InChI | InChI=1S/C19H33NO2Si/c1-18(2,3)23(4,5)22-13-10-16-9-7-12-19-11-6-8-15(19)14-17(21)20(16)19/h8,16H,6-7,9-14H2,1-5H3/t16-,19+/m1/s1 |
| InChIKey | UNTPFKUBARCNRY-APWZRJJASA-N |
| XLogP | 4.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|