C13H22N4 — CID 114276590
1-(2-ethyl-6-methylpyrimidin-4-yl)-3-propylazetidin-3-amine (PubChem CID 114276590) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 1-(2-ethyl-6-methylpyrimidin-4-yl)-3-propylazetidin-3-amine.
| Compound Name | 1-(2-ethyl-6-methylpyrimidin-4-yl)-3-propylazetidin-3-amine |
|---|---|
| PubChem CID | 114276590 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1-(2-ethyl-6-methylpyrimidin-4-yl)-3-propylazetidin-3-amine |
| SMILES | CCCC1(N)CN(c2cc(C)nc(CC)n2)C1 |
| InChI | InChI=1S/C13H22N4/c1-4-6-13(14)8-17(9-13)12-7-10(3)15-11(5-2)16-12/h7H,4-6,8-9,14H2,1-3H3 |
| InChIKey | ZCIHSYSZECRPMF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |