C12H20N4O2 — CID 114277260
3-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]-1-methylpiperidine-2,6-dione (PubChem CID 114277260) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]-1-methylpiperidine-2,6-dione.
| Compound Name | 3-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]-1-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 114277260 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]-1-methylpiperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(NC2=NCC(C)(C)CN2)C1=O |
| InChI | InChI=1S/C12H20N4O2/c1-12(2)6-13-11(14-7-12)15-8-4-5-9(17)16(3)10(8)18/h8H,4-7H2,1-3H3,(H2,13,14,15) |
| InChIKey | NEIBMDJHTCDOIR-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|