C15H23N3 — CID 114277273
N-(2,3,3-trimethylbutyl)-1,4-dihydroquinazolin-2-amine (PubChem CID 114277273) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is N-(2,3,3-trimethylbutyl)-1,4-dihydroquinazolin-2-amine.
| Compound Name | N-(2,3,3-trimethylbutyl)-1,4-dihydroquinazolin-2-amine |
|---|---|
| PubChem CID | 114277273 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | N-(2,3,3-trimethylbutyl)-1,4-dihydroquinazolin-2-amine |
| SMILES | CC(CNC1=NCc2ccccc2N1)C(C)(C)C |
| InChI | InChI=1S/C15H23N3/c1-11(15(2,3)4)9-16-14-17-10-12-7-5-6-8-13(12)18-14/h5-8,11H,9-10H2,1-4H3,(H2,16,17,18) |
| InChIKey | CBCGJFQRCZTAPN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |