About [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol
[4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol (PubChem CID 114277317) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol.
Molecular Properties
| Compound Name | [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol |
| PubChem CID | 114277317 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol |
| SMILES | CC1(C)CN=C(NC2(CO)CCOCC2)NC1 |
| InChI | InChI=1S/C12H23N3O2/c1-11(2)7-13-10(14-8-11)15-12(9-16)3-5-17-6-4-12/h16H,3-9H2,1-2H3,(H2,13,14,15) |
| InChIKey | BWLXHVDXBDFDGO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol?
The IUPAC name of [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol (CID 114277317) is [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol.
What is the SMILES notation for [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol?
The canonical SMILES for [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol is CC1(C)CN=C(NC2(CO)CCOCC2)NC1.
What is the InChIKey of [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol?
The InChIKey is BWLXHVDXBDFDGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2/c1-11(2)7-13-10(14-8-11)15-12(9-16)3-5-17-6-4-12/h16H,3-9H2,1-2H3,(H2,13,14,15).
What are the key properties of [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol?
[4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol has a molecular weight of 241.33 g/mol, XLogP of 0.10, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-yl)amino]oxan-4-yl]methanol is sourced from PubChem (CID 114277317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).