About tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane
tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane (PubChem CID 11427742) has the molecular formula C19H34O3Si
and a molecular weight of 338.56 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane |
| PubChem CID | 11427742 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane |
| SMILES | CCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC[C@@H](c2ccco2)O1 |
| InChI | InChI=1S/C19H34O3Si/c1-7-8-10-18(22-23(5,6)19(2,3)4)17-13-12-16(21-17)15-11-9-14-20-15/h9,11,14,16-18H,7-8,10,12-13H2,1-6H3/t16-,17-,18-/m0/s1 |
| InChIKey | BPTDUZWFOOETBK-BZSNNMDCSA-N |
| XLogP | 6.08 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane (CID 11427742) is tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane is CCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC[C@@H](c2ccco2)O1.
What is the InChIKey of tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane?
The InChIKey is BPTDUZWFOOETBK-BZSNNMDCSA-N. The full InChI is InChI=1S/C19H34O3Si/c1-7-8-10-18(22-23(5,6)19(2,3)4)17-13-12-16(21-17)15-11-9-14-20-15/h9,11,14,16-18H,7-8,10,12-13H2,1-6H3/t16-,17-,18-/m0/s1.
What are the key properties of tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane?
tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane has a molecular weight of 338.56 g/mol, XLogP of 6.08, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1S)-1-[(2S,5S)-5-(furan-2-yl)oxolan-2-yl]pentoxy]-dimethylsilane is sourced from PubChem (CID 11427742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).