C13H25NO3S — CID 114277576
4-[1-(aminomethyl)-4-ethylcyclohexyl]-1,1-dioxothiolan-3-ol (PubChem CID 114277576) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is 4-[1-(aminomethyl)-4-ethylcyclohexyl]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[1-(aminomethyl)-4-ethylcyclohexyl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 114277576 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-[1-(aminomethyl)-4-ethylcyclohexyl]-1,1-dioxothiolan-3-ol |
| SMILES | CCC1CCC(CN)(C2CS(=O)(=O)CC2O)CC1 |
| InChI | InChI=1S/C13H25NO3S/c1-2-10-3-5-13(9-14,6-4-10)11-7-18(16,17)8-12(11)15/h10-12,15H,2-9,14H2,1H3 |
| InChIKey | RWDFEEKZHHLGOB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |