About 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol
2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol (PubChem CID 114277662) has the molecular formula C12H22F3NO2
and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol |
| PubChem CID | 114277662 |
| Molecular Formula | C12H22F3NO2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol |
| SMILES | CC1(C)CCCC(CN)(CCOC(F)(F)F)C1O |
| InChI | InChI=1S/C12H22F3NO2/c1-10(2)4-3-5-11(8-16,9(10)17)6-7-18-12(13,14)15/h9,17H,3-8,16H2,1-2H3 |
| InChIKey | MKEUWFHVZRSZFT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol?
The IUPAC name of 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol (CID 114277662) is 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol.
What is the SMILES notation for 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol?
The canonical SMILES for 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol is CC1(C)CCCC(CN)(CCOC(F)(F)F)C1O.
What is the InChIKey of 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol?
The InChIKey is MKEUWFHVZRSZFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NO2/c1-10(2)4-3-5-11(8-16,9(10)17)6-7-18-12(13,14)15/h9,17H,3-8,16H2,1-2H3.
What are the key properties of 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol?
2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol has a molecular weight of 269.31 g/mol, XLogP of 2.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-6,6-dimethyl-2-[2-(trifluoromethoxy)ethyl]cyclohexan-1-ol is sourced from PubChem (CID 114277662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).