C18H30P2S — CID 11427791
3,4-bis[(2R,5R)-2,5-dimethylphospholan-1-yl]-2,5-dimethylthiophene (PubChem CID 11427791) has the molecular formula C18H30P2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 3,4-bis[(2R,5R)-2,5-dimethylphospholan-1-yl]-2,5-dimethylthiophene.
| Compound Name | 3,4-bis[(2R,5R)-2,5-dimethylphospholan-1-yl]-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 11427791 |
| Molecular Formula | C18H30P2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3,4-bis[(2R,5R)-2,5-dimethylphospholan-1-yl]-2,5-dimethylthiophene |
| SMILES | Cc1sc(C)c(P2[C@H](C)CC[C@H]2C)c1P1[C@H](C)CC[C@H]1C |
| InChI | InChI=1S/C18H30P2S/c1-11-7-8-12(2)19(11)17-15(5)21-16(6)18(17)20-13(3)9-10-14(20)4/h11-14H,7-10H2,1-6H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | QDESAQCWGHWXJF-AAVRWANBSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|