C14H22N2O2 — CID 114278044
2-[2-(3-methoxypropyl)pyrazol-3-yl]cycloheptan-1-one (PubChem CID 114278044) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[2-(3-methoxypropyl)pyrazol-3-yl]cycloheptan-1-one.
| Compound Name | 2-[2-(3-methoxypropyl)pyrazol-3-yl]cycloheptan-1-one |
|---|---|
| PubChem CID | 114278044 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-[2-(3-methoxypropyl)pyrazol-3-yl]cycloheptan-1-one |
| SMILES | COCCCn1nccc1C1CCCCCC1=O |
| InChI | InChI=1S/C14H22N2O2/c1-18-11-5-10-16-13(8-9-15-16)12-6-3-2-4-7-14(12)17/h8-9,12H,2-7,10-11H2,1H3 |
| InChIKey | SYYSIIIKDZESCI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|