C16H33N — CID 114279938
N-[(1R)-1-cyclohexylethyl]-5,5-dimethylhexan-2-amine (PubChem CID 114279938) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexylethyl]-5,5-dimethylhexan-2-amine.
| Compound Name | N-[(1R)-1-cyclohexylethyl]-5,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 114279938 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | N-[(1R)-1-cyclohexylethyl]-5,5-dimethylhexan-2-amine |
| SMILES | CC(CCC(C)(C)C)N[C@H](C)C1CCCCC1 |
| InChI | InChI=1S/C16H33N/c1-13(11-12-16(3,4)5)17-14(2)15-9-7-6-8-10-15/h13-15,17H,6-12H2,1-5H3/t13?,14-/m1/s1 |
| InChIKey | OYLRQZSYBYCXGX-ARLHGKGLSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |