C21H37NOSi — CID 11428001
[(4S,9aR)-4-pent-1-ynyl-4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11428001) has the molecular formula C21H37NOSi and a molecular weight of 347.62 g/mol. Its IUPAC name is [(4S,9aR)-4-pent-1-ynyl-4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S,9aR)-4-pent-1-ynyl-4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11428001 |
| Molecular Formula | C21H37NOSi |
| Molecular Weight | 347.62 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | [(4S,9aR)-4-pent-1-ynyl-4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CCCC#C[C@@H]1CC(CO[Si](C)(C)C(C)(C)C)=C[C@H]2CCCCN12 |
| InChI | InChI=1S/C21H37NOSi/c1-7-8-9-12-19-15-18(16-20-13-10-11-14-22(19)20)17-23-24(5,6)21(2,3)4/h16,19-20H,7-8,10-11,13-15,17H2,1-6H3/t19-,20-/m1/s1 |
| InChIKey | WZECLIZAAXNFKA-WOJBJXKFSA-N |
| XLogP | 5.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|