C18H26ClFN2O2 — CID 114280713
tert-butyl 3-(aminomethyl)-3-[(3-chloro-2-fluorophenyl)methyl]piperidine-1-carboxylate (PubChem CID 114280713) has the molecular formula C18H26ClFN2O2 and a molecular weight of 356.87 g/mol. Its IUPAC name is tert-butyl 3-(aminomethyl)-3-[(3-chloro-2-fluorophenyl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(aminomethyl)-3-[(3-chloro-2-fluorophenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 114280713 |
| Molecular Formula | C18H26ClFN2O2 |
| Molecular Weight | 356.87 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | tert-butyl 3-(aminomethyl)-3-[(3-chloro-2-fluorophenyl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CN)(Cc2cccc(Cl)c2F)C1 |
| InChI | InChI=1S/C18H26ClFN2O2/c1-17(2,3)24-16(23)22-9-5-8-18(11-21,12-22)10-13-6-4-7-14(19)15(13)20/h4,6-7H,5,8-12,21H2,1-3H3 |
| InChIKey | IBXGCOLRHZUKKB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |