About N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine
N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine (PubChem CID 11428096) has the molecular formula C22H29N3O
and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine |
| PubChem CID | 11428096 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine |
| SMILES | Cc1cc(OCCN(C(C)C)C(C)C)c2cc3cccnc3c(C)c2n1 |
| InChI | InChI=1S/C22H29N3O/c1-14(2)25(15(3)4)10-11-26-20-12-16(5)24-22-17(6)21-18(13-19(20)22)8-7-9-23-21/h7-9,12-15H,10-11H2,1-6H3 |
| InChIKey | ZAZPUOWUQMJZRW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine?
The IUPAC name of N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine (CID 11428096) is N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine.
What is the SMILES notation for N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine?
The canonical SMILES for N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine is Cc1cc(OCCN(C(C)C)C(C)C)c2cc3cccnc3c(C)c2n1.
What is the InChIKey of N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine?
The InChIKey is ZAZPUOWUQMJZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O/c1-14(2)25(15(3)4)10-11-26-20-12-16(5)24-22-17(6)21-18(13-19(20)22)8-7-9-23-21/h7-9,12-15H,10-11H2,1-6H3.
What are the key properties of N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine?
N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine has a molecular weight of 351.49 g/mol, XLogP of 4.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,10-dimethylpyrido[3,2-g]quinolin-4-yl)oxyethyl]-N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 11428096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).