C13H19N3O — CID 114281228
2-(2-amino-4,5-dimethylanilino)-N-cyclopropylacetamide (PubChem CID 114281228) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-(2-amino-4,5-dimethylanilino)-N-cyclopropylacetamide.
| Compound Name | 2-(2-amino-4,5-dimethylanilino)-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 114281228 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-(2-amino-4,5-dimethylanilino)-N-cyclopropylacetamide |
| SMILES | Cc1cc(N)c(NCC(=O)NC2CC2)cc1C |
| InChI | InChI=1S/C13H19N3O/c1-8-5-11(14)12(6-9(8)2)15-7-13(17)16-10-3-4-10/h5-6,10,15H,3-4,7,14H2,1-2H3,(H,16,17) |
| InChIKey | ONVJKYYXKRLNDG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|