About 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide
2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide (PubChem CID 114281427) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide |
| PubChem CID | 114281427 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide |
| SMILES | Cc1cc2nc(N)n(C(C)(C)C(N)=O)c2cc1C |
| InChI | InChI=1S/C13H18N4O/c1-7-5-9-10(6-8(7)2)17(12(15)16-9)13(3,4)11(14)18/h5-6H,1-4H3,(H2,14,18)(H2,15,16) |
| InChIKey | NJFXQDXBDDHVRH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide?
The IUPAC name of 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide (CID 114281427) is 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide.
What is the SMILES notation for 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide?
The canonical SMILES for 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide is Cc1cc2nc(N)n(C(C)(C)C(N)=O)c2cc1C.
What is the InChIKey of 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide?
The InChIKey is NJFXQDXBDDHVRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c1-7-5-9-10(6-8(7)2)17(12(15)16-9)13(3,4)11(14)18/h5-6H,1-4H3,(H2,14,18)(H2,15,16).
What are the key properties of 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide?
2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide has a molecular weight of 246.31 g/mol, XLogP of 1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-5,6-dimethylbenzimidazol-1-yl)-2-methylpropanamide is sourced from PubChem (CID 114281427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).