C16H17BrO4 — CID 11428144
(3S,5R)-9-bromo-6,6-dimethoxy-3-phenyl-1,4-dioxaspiro[4.5]deca-7,9-diene (PubChem CID 11428144) has the molecular formula C16H17BrO4 and a molecular weight of 353.21 g/mol. Its IUPAC name is (3S,5R)-9-bromo-6,6-dimethoxy-3-phenyl-1,4-dioxaspiro[4.5]deca-7,9-diene.
| Compound Name | (3S,5R)-9-bromo-6,6-dimethoxy-3-phenyl-1,4-dioxaspiro[4.5]deca-7,9-diene |
|---|---|
| PubChem CID | 11428144 |
| Molecular Formula | C16H17BrO4 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | (3S,5R)-9-bromo-6,6-dimethoxy-3-phenyl-1,4-dioxaspiro[4.5]deca-7,9-diene |
| SMILES | COC1(OC)C=CC(Br)=C[C@]12OC[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/C16H17BrO4/c1-18-15(19-2)9-8-13(17)10-16(15)20-11-14(21-16)12-6-4-3-5-7-12/h3-10,14H,11H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | JZKIYGPOYXVUII-GDBMZVCRSA-N |
| XLogP | 3.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|