C12H13N3O2 — CID 114281510
5-amino-2-[(5-oxopyrrolidin-2-yl)methoxy]benzonitrile (PubChem CID 114281510) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-amino-2-[(5-oxopyrrolidin-2-yl)methoxy]benzonitrile.
| Compound Name | 5-amino-2-[(5-oxopyrrolidin-2-yl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 114281510 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-amino-2-[(5-oxopyrrolidin-2-yl)methoxy]benzonitrile |
| SMILES | N#Cc1cc(N)ccc1OCC1CCC(=O)N1 |
| InChI | InChI=1S/C12H13N3O2/c13-6-8-5-9(14)1-3-11(8)17-7-10-2-4-12(16)15-10/h1,3,5,10H,2,4,7,14H2,(H,15,16) |
| InChIKey | JKCWPEFKAXZCFS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|