C20H38O3Si — CID 11428199
ethyl 3-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]propanoate (PubChem CID 11428199) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is ethyl 3-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]propanoate.
| Compound Name | ethyl 3-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]propanoate |
|---|---|
| PubChem CID | 11428199 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | ethyl 3-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]propanoate |
| SMILES | CCOC(=O)CC[C@]12CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCC2 |
| InChI | InChI=1S/C20H38O3Si/c1-7-22-18(21)12-15-20-13-8-10-16(20)17(11-9-14-20)23-24(5,6)19(2,3)4/h16-17H,7-15H2,1-6H3/t16-,17+,20-/m0/s1 |
| InChIKey | GSDZIZKOVJWEPN-QKLQHJQFSA-N |
| XLogP | 5.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|