About N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide
N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide (PubChem CID 11428282) has the molecular formula C23H23N3O
and a molecular weight of 357.46 g/mol. Its IUPAC name is N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide |
| PubChem CID | 11428282 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1)C1CCCCC1 |
| InChI | InChI=1S/C23H23N3O/c27-22(19-14-8-3-9-15-19)26-23-24-20(17-10-4-1-5-11-17)16-21(25-23)18-12-6-2-7-13-18/h1-2,4-7,10-13,16,19H,3,8-9,14-15H2,(H,24,25,26,27) |
| InChIKey | GGZRKRPYGJABPL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide?
The IUPAC name of N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide (CID 11428282) is N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide.
What is the SMILES notation for N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide?
The canonical SMILES for N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide is O=C(Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1)C1CCCCC1.
What is the InChIKey of N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide?
The InChIKey is GGZRKRPYGJABPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O/c27-22(19-14-8-3-9-15-19)26-23-24-20(17-10-4-1-5-11-17)16-21(25-23)18-12-6-2-7-13-18/h1-2,4-7,10-13,16,19H,3,8-9,14-15H2,(H,24,25,26,27).
What are the key properties of N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide?
N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide has a molecular weight of 357.46 g/mol, XLogP of 5.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-diphenylpyrimidin-2-yl)cyclohexanecarboxamide is sourced from PubChem (CID 11428282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).