About 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine
6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine (PubChem CID 11428301) has the molecular formula C18H16F2N4O2
and a molecular weight of 358.35 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine |
| PubChem CID | 11428301 |
| Molecular Formula | C18H16F2N4O2 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine |
| SMILES | Fc1ccc(Oc2cc3cnc(NC4CCOCC4)nc3cn2)c(F)c1 |
| InChI | InChI=1S/C18H16F2N4O2/c19-12-1-2-16(14(20)8-12)26-17-7-11-9-22-18(24-15(11)10-21-17)23-13-3-5-25-6-4-13/h1-2,7-10,13H,3-6H2,(H,22,23,24) |
| InChIKey | ZQIBVNCOZHXDJX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine?
The IUPAC name of 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine (CID 11428301) is 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine.
What is the SMILES notation for 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine?
The canonical SMILES for 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine is Fc1ccc(Oc2cc3cnc(NC4CCOCC4)nc3cn2)c(F)c1.
What is the InChIKey of 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine?
The InChIKey is ZQIBVNCOZHXDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2N4O2/c19-12-1-2-16(14(20)8-12)26-17-7-11-9-22-18(24-15(11)10-21-17)23-13-3-5-25-6-4-13/h1-2,7-10,13H,3-6H2,(H,22,23,24).
What are the key properties of 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine?
6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine has a molecular weight of 358.35 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-difluorophenoxy)-N-(oxan-4-yl)pyrido[3,4-d]pyrimidin-2-amine is sourced from PubChem (CID 11428301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).