C12H13ClN2O3 — CID 114284183
1-(2-chlorofuran-3-carbonyl)-4-methoxypiperidine-4-carbonitrile (PubChem CID 114284183) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 1-(2-chlorofuran-3-carbonyl)-4-methoxypiperidine-4-carbonitrile.
| Compound Name | 1-(2-chlorofuran-3-carbonyl)-4-methoxypiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 114284183 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(2-chlorofuran-3-carbonyl)-4-methoxypiperidine-4-carbonitrile |
| SMILES | COC1(C#N)CCN(C(=O)c2ccoc2Cl)CC1 |
| InChI | InChI=1S/C12H13ClN2O3/c1-17-12(8-14)3-5-15(6-4-12)11(16)9-2-7-18-10(9)13/h2,7H,3-6H2,1H3 |
| InChIKey | AJDKHURAXOHCMY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |