C23H42OSi — CID 11428450
6-ethenyl-2,4-dihexyl-5-trimethylsilylcyclohexa-2,4-dien-1-ol (PubChem CID 11428450) has the molecular formula C23H42OSi and a molecular weight of 362.67 g/mol. Its IUPAC name is 6-ethenyl-2,4-dihexyl-5-trimethylsilylcyclohexa-2,4-dien-1-ol.
| Compound Name | 6-ethenyl-2,4-dihexyl-5-trimethylsilylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 11428450 |
| Molecular Formula | C23H42OSi |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 6-ethenyl-2,4-dihexyl-5-trimethylsilylcyclohexa-2,4-dien-1-ol |
| SMILES | C=CC1C([Si](C)(C)C)=C(CCCCCC)C=C(CCCCCC)C1O |
| InChI | InChI=1S/C23H42OSi/c1-7-10-12-14-16-19-18-20(17-15-13-11-8-2)23(25(4,5)6)21(9-3)22(19)24/h9,18,21-22,24H,3,7-8,10-17H2,1-2,4-6H3 |
| InChIKey | BZWUBOXXYOXGHP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|